C8H7F5N2O2 — CID 125479656
1,3-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine-2,4-dione (PubChem CID 125479656) has the molecular formula C8H7F5N2O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is 1,3-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 125479656 |
| Molecular Formula | C8H7F5N2O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1,3-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(C(F)(F)C(F)(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H7F5N2O2/c1-14-3-4(5(16)15(2)6(14)17)7(9,10)8(11,12)13/h3H,1-2H3 |
| InChIKey | NROFFEHQSZFBAI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|