About (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione
(4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione (PubChem CID 125479891) has the molecular formula C12H10F2O2
and a molecular weight of 224.21 g/mol. Its IUPAC name is (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione |
| PubChem CID | 125479891 |
| Molecular Formula | C12H10F2O2 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione |
| SMILES | O=C1CC[C@@H](c2cc(F)ccc2F)C(=O)C1 |
| InChI | InChI=1S/C12H10F2O2/c13-7-1-4-11(14)10(5-7)9-3-2-8(15)6-12(9)16/h1,4-5,9H,2-3,6H2/t9-/m0/s1 |
| InChIKey | VTJSDWNCSTUBRZ-VIFPVBQESA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione?
The IUPAC name of (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione (CID 125479891) is (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione.
What is the SMILES notation for (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione?
The canonical SMILES for (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione is O=C1CC[C@@H](c2cc(F)ccc2F)C(=O)C1.
What is the InChIKey of (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione?
The InChIKey is VTJSDWNCSTUBRZ-VIFPVBQESA-N. The full InChI is InChI=1S/C12H10F2O2/c13-7-1-4-11(14)10(5-7)9-3-2-8(15)6-12(9)16/h1,4-5,9H,2-3,6H2/t9-/m0/s1.
What are the key properties of (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione?
(4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione has a molecular weight of 224.21 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2,5-difluorophenyl)cyclohexane-1,3-dione is sourced from PubChem (CID 125479891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).