About (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane
(2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane (PubChem CID 125479934) has the molecular formula C17H16Br2O2
and a molecular weight of 412.12 g/mol. Its IUPAC name is (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane |
| PubChem CID | 125479934 |
| Molecular Formula | C17H16Br2O2 |
| Molecular Weight | 412.12 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane |
| SMILES | Cc1ccc([C@@H]2CO[C@](CBr)(c3ccc(Br)cc3)O2)cc1 |
| InChI | InChI=1S/C17H16Br2O2/c1-12-2-4-13(5-3-12)16-10-20-17(11-18,21-16)14-6-8-15(19)9-7-14/h2-9,16H,10-11H2,1H3/t16-,17-/m0/s1 |
| InChIKey | WDCWZDFSTDPVDM-IRXDYDNUSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane?
The IUPAC name of (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane (CID 125479934) is (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane.
What is the SMILES notation for (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane?
The canonical SMILES for (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane is Cc1ccc([C@@H]2CO[C@](CBr)(c3ccc(Br)cc3)O2)cc1.
What is the InChIKey of (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane?
The InChIKey is WDCWZDFSTDPVDM-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H16Br2O2/c1-12-2-4-13(5-3-12)16-10-20-17(11-18,21-16)14-6-8-15(19)9-7-14/h2-9,16H,10-11H2,1H3/t16-,17-/m0/s1.
What are the key properties of (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane?
(2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane has a molecular weight of 412.12 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-(bromomethyl)-2-(4-bromophenyl)-4-(4-methylphenyl)-1,3-dioxolane is sourced from PubChem (CID 125479934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).