C39H30BrN3 — CID 125479952
2-(4-bromophenyl)-4,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazine (PubChem CID 125479952) has the molecular formula C39H30BrN3 and a molecular weight of 620.59 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazine.
| Compound Name | 2-(4-bromophenyl)-4,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 125479952 |
| Molecular Formula | C39H30BrN3 |
| Molecular Weight | 620.59 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-(4-bromophenyl)-4,6-bis(9,9-dimethylfluoren-3-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3nc(-c4ccc(Br)cc4)nc(-c4ccc5c(c4)-c4ccccc4C5(C)C)n3)ccc21 |
| InChI | InChI=1S/C39H30BrN3/c1-38(2)31-11-7-5-9-27(31)29-21-24(15-19-33(29)38)36-41-35(23-13-17-26(40)18-14-23)42-37(43-36)25-16-20-34-30(22-25)28-10-6-8-12-32(28)39(34,3)4/h5-22H,1-4H3 |
| InChIKey | QASJJJXBSVJBFW-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.59 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |