C26H22ClN3 — CID 125480095
2-chloro-4-(9,9-diethylfluoren-2-yl)-6-phenyl-1,3,5-triazine (PubChem CID 125480095) has the molecular formula C26H22ClN3 and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-chloro-4-(9,9-diethylfluoren-2-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(9,9-diethylfluoren-2-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 125480095 |
| Molecular Formula | C26H22ClN3 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-chloro-4-(9,9-diethylfluoren-2-yl)-6-phenyl-1,3,5-triazine |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(-c3nc(Cl)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C26H22ClN3/c1-3-26(4-2)21-13-9-8-12-19(21)20-15-14-18(16-22(20)26)24-28-23(29-25(27)30-24)17-10-6-5-7-11-17/h5-16H,3-4H2,1-2H3 |
| InChIKey | VTDGOVSQNKJRPY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |