About 1-chloro-4,5-dipropyl-2,3-dihydroborole
1-chloro-4,5-dipropyl-2,3-dihydroborole (PubChem CID 125480448) has the molecular formula C10H18BCl
and a molecular weight of 184.52 g/mol. Its IUPAC name is 1-chloro-4,5-dipropyl-2,3-dihydroborole.
Molecular Properties
| Compound Name | 1-chloro-4,5-dipropyl-2,3-dihydroborole |
| PubChem CID | 125480448 |
| Molecular Formula | C10H18BCl |
| Molecular Weight | 184.52 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-chloro-4,5-dipropyl-2,3-dihydroborole |
| SMILES | CCCC1=C(CCC)B(Cl)CC1 |
| InChI | InChI=1S/C10H18BCl/c1-3-5-9-7-8-11(12)10(9)6-4-2/h3-8H2,1-2H3 |
| InChIKey | BOAOOGZMPYFIJO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4,5-dipropyl-2,3-dihydroborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4,5-dipropyl-2,3-dihydroborole?
The IUPAC name of 1-chloro-4,5-dipropyl-2,3-dihydroborole (CID 125480448) is 1-chloro-4,5-dipropyl-2,3-dihydroborole.
What is the SMILES notation for 1-chloro-4,5-dipropyl-2,3-dihydroborole?
The canonical SMILES for 1-chloro-4,5-dipropyl-2,3-dihydroborole is CCCC1=C(CCC)B(Cl)CC1.
What is the InChIKey of 1-chloro-4,5-dipropyl-2,3-dihydroborole?
The InChIKey is BOAOOGZMPYFIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BCl/c1-3-5-9-7-8-11(12)10(9)6-4-2/h3-8H2,1-2H3.
What are the key properties of 1-chloro-4,5-dipropyl-2,3-dihydroborole?
1-chloro-4,5-dipropyl-2,3-dihydroborole has a molecular weight of 184.52 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4,5-dipropyl-2,3-dihydroborole is sourced from PubChem (CID 125480448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).