About 6-(3,3-difluoroazetidin-1-yl)hexanenitrile
6-(3,3-difluoroazetidin-1-yl)hexanenitrile (PubChem CID 125480729) has the molecular formula C9H14F2N2
and a molecular weight of 188.22 g/mol. Its IUPAC name is 6-(3,3-difluoroazetidin-1-yl)hexanenitrile.
Molecular Properties
| Compound Name | 6-(3,3-difluoroazetidin-1-yl)hexanenitrile |
| PubChem CID | 125480729 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-(3,3-difluoroazetidin-1-yl)hexanenitrile |
| SMILES | N#CCCCCCN1CC(F)(F)C1 |
| InChI | InChI=1S/C9H14F2N2/c10-9(11)7-13(8-9)6-4-2-1-3-5-12/h1-4,6-8H2 |
| InChIKey | VOBFBMCKYOGBNZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,3-difluoroazetidin-1-yl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-difluoroazetidin-1-yl)hexanenitrile?
The IUPAC name of 6-(3,3-difluoroazetidin-1-yl)hexanenitrile (CID 125480729) is 6-(3,3-difluoroazetidin-1-yl)hexanenitrile.
What is the SMILES notation for 6-(3,3-difluoroazetidin-1-yl)hexanenitrile?
The canonical SMILES for 6-(3,3-difluoroazetidin-1-yl)hexanenitrile is N#CCCCCCN1CC(F)(F)C1.
What is the InChIKey of 6-(3,3-difluoroazetidin-1-yl)hexanenitrile?
The InChIKey is VOBFBMCKYOGBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2/c10-9(11)7-13(8-9)6-4-2-1-3-5-12/h1-4,6-8H2.
What are the key properties of 6-(3,3-difluoroazetidin-1-yl)hexanenitrile?
6-(3,3-difluoroazetidin-1-yl)hexanenitrile has a molecular weight of 188.22 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-difluoroazetidin-1-yl)hexanenitrile is sourced from PubChem (CID 125480729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).