C15H13IO2 — CID 125481734
(1R,3S)-2-(4-iodophenyl)-2,3-dihydro-1H-indene-1,3-diol (PubChem CID 125481734) has the molecular formula C15H13IO2 and a molecular weight of 352.17 g/mol. Its IUPAC name is (1R,3S)-2-(4-iodophenyl)-2,3-dihydro-1H-indene-1,3-diol.
| Compound Name | (1R,3S)-2-(4-iodophenyl)-2,3-dihydro-1H-indene-1,3-diol |
|---|---|
| PubChem CID | 125481734 |
| Molecular Formula | C15H13IO2 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (1R,3S)-2-(4-iodophenyl)-2,3-dihydro-1H-indene-1,3-diol |
| SMILES | O[C@@H]1c2ccccc2[C@H](O)C1c1ccc(I)cc1 |
| InChI | InChI=1S/C15H13IO2/c16-10-7-5-9(6-8-10)13-14(17)11-3-1-2-4-12(11)15(13)18/h1-8,13-15,17-18H/t13?,14-,15+ |
| InChIKey | PQKYNBASHORKIO-GOOCMWNKSA-N |
| XLogP | 3.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|