C12H15FN2 — CID 125482074
2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindol-5-amine (PubChem CID 125482074) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 125482074 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindol-5-amine |
| SMILES | Nc1ccc2c(c1)CN(CC1(F)CC1)C2 |
| InChI | InChI=1S/C12H15FN2/c13-12(3-4-12)8-15-6-9-1-2-11(14)5-10(9)7-15/h1-2,5H,3-4,6-8,14H2 |
| InChIKey | JCGUJECKTOPXGG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|