C17H9Cl3O2 — CID 125482898
5,7-dichloro-3-(4-chlorophenoxy)naphthalene-1-carbaldehyde (PubChem CID 125482898) has the molecular formula C17H9Cl3O2 and a molecular weight of 351.62 g/mol. Its IUPAC name is 5,7-dichloro-3-(4-chlorophenoxy)naphthalene-1-carbaldehyde.
| Compound Name | 5,7-dichloro-3-(4-chlorophenoxy)naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 125482898 |
| Molecular Formula | C17H9Cl3O2 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 5,7-dichloro-3-(4-chlorophenoxy)naphthalene-1-carbaldehyde |
| SMILES | O=Cc1cc(Oc2ccc(Cl)cc2)cc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C17H9Cl3O2/c18-11-1-3-13(4-2-11)22-14-5-10(9-21)15-6-12(19)7-17(20)16(15)8-14/h1-9H |
| InChIKey | XYDKEQWLDXOOSM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|