C13H18ClFN4O2 — CID 125483093
ethyl 3-[4-(6-chloro-5-fluoropyrimidin-4-yl)piperazin-1-yl]propanoate (PubChem CID 125483093) has the molecular formula C13H18ClFN4O2 and a molecular weight of 316.76 g/mol. Its IUPAC name is ethyl 3-[4-(6-chloro-5-fluoropyrimidin-4-yl)piperazin-1-yl]propanoate.
| Compound Name | ethyl 3-[4-(6-chloro-5-fluoropyrimidin-4-yl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 125483093 |
| Molecular Formula | C13H18ClFN4O2 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl 3-[4-(6-chloro-5-fluoropyrimidin-4-yl)piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(c2ncnc(Cl)c2F)CC1 |
| InChI | InChI=1S/C13H18ClFN4O2/c1-2-21-10(20)3-4-18-5-7-19(8-6-18)13-11(15)12(14)16-9-17-13/h9H,2-8H2,1H3 |
| InChIKey | YLSSEERCGPVOND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |