C13H19N3O — CID 125483571
(1R)-N'-hydroxy-1,3,3-trimethyl-1,4-dihydroisoquinoline-2-carboximidamide (PubChem CID 125483571) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (1R)-N'-hydroxy-1,3,3-trimethyl-1,4-dihydroisoquinoline-2-carboximidamide.
| Compound Name | (1R)-N'-hydroxy-1,3,3-trimethyl-1,4-dihydroisoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 125483571 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1R)-N'-hydroxy-1,3,3-trimethyl-1,4-dihydroisoquinoline-2-carboximidamide |
| SMILES | C[C@@H]1c2ccccc2CC(C)(C)N1C(N)=NO |
| InChI | InChI=1S/C13H19N3O/c1-9-11-7-5-4-6-10(11)8-13(2,3)16(9)12(14)15-17/h4-7,9,17H,8H2,1-3H3,(H2,14,15)/t9-/m1/s1 |
| InChIKey | AMBLZVYIGPAQBL-SECBINFHSA-N |
| XLogP | 2.09 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|