C16H20O2 — CID 125483700
(3S,4aS,8aS)-3-hydroxy-3-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 125483700) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3S,4aS,8aS)-3-hydroxy-3-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3S,4aS,8aS)-3-hydroxy-3-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 125483700 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3S,4aS,8aS)-3-hydroxy-3-phenyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | O=C1C[C@@H]2CCCC[C@H]2C[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C16H20O2/c17-15-10-12-6-4-5-7-13(12)11-16(15,18)14-8-2-1-3-9-14/h1-3,8-9,12-13,18H,4-7,10-11H2/t12-,13-,16-/m0/s1 |
| InChIKey | OUIJSJCXKIPUMN-XEZPLFJOSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |