C13H7F7 — CID 125484046
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)naphthalene (PubChem CID 125484046) has the molecular formula C13H7F7 and a molecular weight of 296.19 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)naphthalene.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)naphthalene |
|---|---|
| PubChem CID | 125484046 |
| Molecular Formula | C13H7F7 |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)naphthalene |
| SMILES | FC(F)(F)C(F)(c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C13H7F7/c14-11(12(15,16)17,13(18,19)20)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | YJSZKBRBJZKRTE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |