C12H14ClF2NO — CID 125484423
2-(4-chlorophenyl)-N,N-diethyl-2,2-difluoroacetamide (PubChem CID 125484423) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-diethyl-2,2-difluoroacetamide.
| Compound Name | 2-(4-chlorophenyl)-N,N-diethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 125484423 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-diethyl-2,2-difluoroacetamide |
| SMILES | CCN(CC)C(=O)C(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClF2NO/c1-3-16(4-2)11(17)12(14,15)9-5-7-10(13)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | KKLVYCFOWGGSFH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |