C11H11NO3 — CID 125484491
2-[(1R)-5-methyl-2-nitrocyclohexa-2,4-dien-1-yl]furan (PubChem CID 125484491) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[(1R)-5-methyl-2-nitrocyclohexa-2,4-dien-1-yl]furan.
| Compound Name | 2-[(1R)-5-methyl-2-nitrocyclohexa-2,4-dien-1-yl]furan |
|---|---|
| PubChem CID | 125484491 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-[(1R)-5-methyl-2-nitrocyclohexa-2,4-dien-1-yl]furan |
| SMILES | CC1=CC=C([N+](=O)[O-])[C@H](c2ccco2)C1 |
| InChI | InChI=1S/C11H11NO3/c1-8-4-5-10(12(13)14)9(7-8)11-3-2-6-15-11/h2-6,9H,7H2,1H3/t9-/m1/s1 |
| InChIKey | VAOVHWJBUJALLN-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|