C14H28N2 — CID 125485118
(2R,4aR,6R,8aR)-2-N,2-N,6-N,6-N-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-diamine (PubChem CID 125485118) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (2R,4aR,6R,8aR)-2-N,2-N,6-N,6-N-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-diamine.
| Compound Name | (2R,4aR,6R,8aR)-2-N,2-N,6-N,6-N-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 125485118 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (2R,4aR,6R,8aR)-2-N,2-N,6-N,6-N-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-diamine |
| SMILES | CN(C)[C@@H]1CC[C@@H]2C[C@H](N(C)C)CC[C@@H]2C1 |
| InChI | InChI=1S/C14H28N2/c1-15(2)13-7-5-12-10-14(16(3)4)8-6-11(12)9-13/h11-14H,5-10H2,1-4H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | OVSOMETVDKFNNR-AAVRWANBSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |