About 2-butyl-6-chloroindazole
2-butyl-6-chloroindazole (PubChem CID 125485264) has the molecular formula C11H13ClN2
and a molecular weight of 208.69 g/mol. Its IUPAC name is 2-butyl-6-chloroindazole.
Molecular Properties
| Compound Name | 2-butyl-6-chloroindazole |
| PubChem CID | 125485264 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-butyl-6-chloroindazole |
| SMILES | CCCCn1cc2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C11H13ClN2/c1-2-3-6-14-8-9-4-5-10(12)7-11(9)13-14/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | MAKDMPFIUAPHBT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6-chloroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-chloroindazole?
The IUPAC name of 2-butyl-6-chloroindazole (CID 125485264) is 2-butyl-6-chloroindazole.
What is the SMILES notation for 2-butyl-6-chloroindazole?
The canonical SMILES for 2-butyl-6-chloroindazole is CCCCn1cc2ccc(Cl)cc2n1.
What is the InChIKey of 2-butyl-6-chloroindazole?
The InChIKey is MAKDMPFIUAPHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2/c1-2-3-6-14-8-9-4-5-10(12)7-11(9)13-14/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 2-butyl-6-chloroindazole?
2-butyl-6-chloroindazole has a molecular weight of 208.69 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-chloroindazole is sourced from PubChem (CID 125485264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).