C12H14BrFO — CID 125485533
(2S)-2-bromo-1-(3,5-dimethylphenyl)-2-fluorobutan-1-one (PubChem CID 125485533) has the molecular formula C12H14BrFO and a molecular weight of 273.14 g/mol. Its IUPAC name is (2S)-2-bromo-1-(3,5-dimethylphenyl)-2-fluorobutan-1-one.
| Compound Name | (2S)-2-bromo-1-(3,5-dimethylphenyl)-2-fluorobutan-1-one |
|---|---|
| PubChem CID | 125485533 |
| Molecular Formula | C12H14BrFO |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (2S)-2-bromo-1-(3,5-dimethylphenyl)-2-fluorobutan-1-one |
| SMILES | CC[C@](F)(Br)C(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H14BrFO/c1-4-12(13,14)11(15)10-6-8(2)5-9(3)7-10/h5-7H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | WKIYPQUIBWLCTL-GFCCVEGCSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|