About dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane
dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane (PubChem CID 12548566) has the molecular formula C9H9Cl8O3P
and a molecular weight of 479.77 g/mol. Its IUPAC name is dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane.
Molecular Properties
| Compound Name | dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane |
| PubChem CID | 12548566 |
| Molecular Formula | C9H9Cl8O3P |
| Molecular Weight | 479.77 g/mol |
| Exact Mass | 475.78 |
| IUPAC Name | dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane |
| SMILES | CC(OP(Cl)(Cl)(OC(C)=C(Cl)Cl)OC(C)=C(Cl)Cl)=C(Cl)Cl |
| InChI | InChI=1S/C9H9Cl8O3P/c1-4(7(10)11)18-21(16,17,19-5(2)8(12)13)20-6(3)9(14)15/h1-3H3 |
| InChIKey | MGUIVGSUDWLANW-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.77 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane?
The IUPAC name of dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane (CID 12548566) is dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane.
What is the SMILES notation for dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane?
The canonical SMILES for dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane is CC(OP(Cl)(Cl)(OC(C)=C(Cl)Cl)OC(C)=C(Cl)Cl)=C(Cl)Cl.
What is the InChIKey of dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane?
The InChIKey is MGUIVGSUDWLANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl8O3P/c1-4(7(10)11)18-21(16,17,19-5(2)8(12)13)20-6(3)9(14)15/h1-3H3.
What are the key properties of dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane?
dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane has a molecular weight of 479.77 g/mol, XLogP of 8.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-tris(1,1-dichloroprop-1-en-2-yloxy)-λ5-phosphane is sourced from PubChem (CID 12548566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).