About 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one
2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one (PubChem CID 125486139) has the molecular formula C9H11FO3
and a molecular weight of 186.18 g/mol. Its IUPAC name is 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one |
| PubChem CID | 125486139 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC)C=CC(=O)C(F)=C1C |
| InChI | InChI=1S/C9H11FO3/c1-6-8(10)7(11)4-5-9(6,12-2)13-3/h4-5H,1-3H3 |
| InChIKey | WSJUSZMIHVUUAX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one?
The IUPAC name of 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one (CID 125486139) is 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one is COC1(OC)C=CC(=O)C(F)=C1C.
What is the InChIKey of 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one?
The InChIKey is WSJUSZMIHVUUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO3/c1-6-8(10)7(11)4-5-9(6,12-2)13-3/h4-5H,1-3H3.
What are the key properties of 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one?
2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one has a molecular weight of 186.18 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,4-dimethoxy-3-methylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 125486139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).