About 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole
5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole (PubChem CID 125486164) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole |
| PubChem CID | 125486164 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole |
| SMILES | COc1ccc(C2=C[C@@H](C)[C@H](c3nn[nH]n3)CC2)cc1 |
| InChI | InChI=1S/C15H18N4O/c1-10-9-12(11-3-6-13(20-2)7-4-11)5-8-14(10)15-16-18-19-17-15/h3-4,6-7,9-10,14H,5,8H2,1-2H3,(H,16,17,18,19)/t10-,14-/m1/s1 |
| InChIKey | OWPJQJLZDJBDFR-QMTHXVAHSA-N |
| XLogP | 2.81 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole?
The IUPAC name of 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole (CID 125486164) is 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole.
What is the SMILES notation for 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole?
The canonical SMILES for 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole is COc1ccc(C2=C[C@@H](C)[C@H](c3nn[nH]n3)CC2)cc1.
What is the InChIKey of 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole?
The InChIKey is OWPJQJLZDJBDFR-QMTHXVAHSA-N. The full InChI is InChI=1S/C15H18N4O/c1-10-9-12(11-3-6-13(20-2)7-4-11)5-8-14(10)15-16-18-19-17-15/h3-4,6-7,9-10,14H,5,8H2,1-2H3,(H,16,17,18,19)/t10-,14-/m1/s1.
What are the key properties of 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole?
5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole has a molecular weight of 270.34 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,2R)-4-(4-methoxyphenyl)-2-methylcyclohex-3-en-1-yl]-2H-tetrazole is sourced from PubChem (CID 125486164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).