C13H17NO2 — CID 125486684
(NZ)-N-[[(2S)-6-(methoxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methylidene]hydroxylamine (PubChem CID 125486684) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (NZ)-N-[[(2S)-6-(methoxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[(2S)-6-(methoxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 125486684 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (NZ)-N-[[(2S)-6-(methoxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methylidene]hydroxylamine |
| SMILES | COCc1ccc2c(c1)CC[C@H](/C=N\O)C2 |
| InChI | InChI=1S/C13H17NO2/c1-16-9-11-3-5-12-6-10(8-14-15)2-4-13(12)7-11/h3,5,7-8,10,15H,2,4,6,9H2,1H3/b14-8-/t10-/m0/s1 |
| InChIKey | YQJVSVDMAIVULF-WULZRQGASA-N |
| XLogP | 2.40 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|