About (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol
(1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol (PubChem CID 125486890) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol.
Molecular Properties
| Compound Name | (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol |
| PubChem CID | 125486890 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol |
| SMILES | C=CCNC[C@@H](O)[C@@H]1CCc2ccccc2O1 |
| InChI | InChI=1S/C14H19NO2/c1-2-9-15-10-12(16)14-8-7-11-5-3-4-6-13(11)17-14/h2-6,12,14-16H,1,7-10H2/t12-,14+/m1/s1 |
| InChIKey | VUNDEVOKFIWHHG-OCCSQVGLSA-N |
| XLogP | 1.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol?
The IUPAC name of (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol (CID 125486890) is (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol.
What is the SMILES notation for (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol?
The canonical SMILES for (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol is C=CCNC[C@@H](O)[C@@H]1CCc2ccccc2O1.
What is the InChIKey of (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol?
The InChIKey is VUNDEVOKFIWHHG-OCCSQVGLSA-N. The full InChI is InChI=1S/C14H19NO2/c1-2-9-15-10-12(16)14-8-7-11-5-3-4-6-13(11)17-14/h2-6,12,14-16H,1,7-10H2/t12-,14+/m1/s1.
What are the key properties of (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol?
(1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol has a molecular weight of 233.31 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(2S)-3,4-dihydro-2H-chromen-2-yl]-2-(prop-2-enylamino)ethanol is sourced from PubChem (CID 125486890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).