C19H20O3 — CID 125487195
[(5R)-5-[(4-hydroxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] acetate (PubChem CID 125487195) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is [(5R)-5-[(4-hydroxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] acetate.
| Compound Name | [(5R)-5-[(4-hydroxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 125487195 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(5R)-5-[(4-hydroxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC[C@@H]2Cc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O3/c1-13(20)22-18-9-10-19-15(3-2-4-16(19)12-18)11-14-5-7-17(21)8-6-14/h5-10,12,15,21H,2-4,11H2,1H3/t15-/m1/s1 |
| InChIKey | XWEMFHRUQYJVKC-OAHLLOKOSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|