About 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine
5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine (PubChem CID 125487494) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine.
Molecular Properties
| Compound Name | 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine |
| PubChem CID | 125487494 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine |
| SMILES | CCc1ccc(CCN2C[C@H](CC)CC[C@@H]2C)nc1 |
| InChI | InChI=1S/C17H28N2/c1-4-15-8-9-17(18-12-15)10-11-19-13-16(5-2)7-6-14(19)3/h8-9,12,14,16H,4-7,10-11,13H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | QTPROHSMPMFRLT-GOEBONIOSA-N |
| XLogP | 3.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine?
The IUPAC name of 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine (CID 125487494) is 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine.
What is the SMILES notation for 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine?
The canonical SMILES for 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine is CCc1ccc(CCN2C[C@H](CC)CC[C@@H]2C)nc1.
What is the InChIKey of 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine?
The InChIKey is QTPROHSMPMFRLT-GOEBONIOSA-N. The full InChI is InChI=1S/C17H28N2/c1-4-15-8-9-17(18-12-15)10-11-19-13-16(5-2)7-6-14(19)3/h8-9,12,14,16H,4-7,10-11,13H2,1-3H3/t14-,16+/m0/s1.
What are the key properties of 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine?
5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine has a molecular weight of 260.43 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-[2-[(2S,5R)-5-ethyl-2-methylpiperidin-1-yl]ethyl]pyridine is sourced from PubChem (CID 125487494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).