C15H22BrNO3 — CID 125487722
(2S)-1-(4-bromo-2-prop-2-enoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 125487722) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is (2S)-1-(4-bromo-2-prop-2-enoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (2S)-1-(4-bromo-2-prop-2-enoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 125487722 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2S)-1-(4-bromo-2-prop-2-enoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | C=CCOc1cc(Br)ccc1OC[C@@H](O)CNC(C)C |
| InChI | InChI=1S/C15H22BrNO3/c1-4-7-19-15-8-12(16)5-6-14(15)20-10-13(18)9-17-11(2)3/h4-6,8,11,13,17-18H,1,7,9-10H2,2-3H3/t13-/m0/s1 |
| InChIKey | OYPMPRGUCFNFJW-ZDUSSCGKSA-N |
| XLogP | 2.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|