About 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid
3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid (PubChem CID 125487997) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid.
Molecular Properties
| Compound Name | 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid |
| PubChem CID | 125487997 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid |
| SMILES | CO[C@H]1CC(C#CC(=O)O)C[C@H]1OC |
| InChI | InChI=1S/C10H14O4/c1-13-8-5-7(3-4-10(11)12)6-9(8)14-2/h7-9H,5-6H2,1-2H3,(H,11,12)/t7?,8-,9+ |
| InChIKey | VTMQZTLUFHHEBT-CBLAIPOGSA-N |
| XLogP | 0.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid?
The IUPAC name of 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid (CID 125487997) is 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid.
What is the SMILES notation for 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid?
The canonical SMILES for 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid is CO[C@H]1CC(C#CC(=O)O)C[C@H]1OC.
What is the InChIKey of 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid?
The InChIKey is VTMQZTLUFHHEBT-CBLAIPOGSA-N. The full InChI is InChI=1S/C10H14O4/c1-13-8-5-7(3-4-10(11)12)6-9(8)14-2/h7-9H,5-6H2,1-2H3,(H,11,12)/t7?,8-,9+.
What are the key properties of 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid?
3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid has a molecular weight of 198.22 g/mol, XLogP of 0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S,4R)-3,4-dimethoxycyclopentyl]prop-2-ynoic acid is sourced from PubChem (CID 125487997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).