C13H14N3O4S+ — CID 125488273
(E)-2-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-oxopyrrolidin-1-yl)ethenediazonium (PubChem CID 125488273) has the molecular formula C13H14N3O4S+ and a molecular weight of 308.34 g/mol. Its IUPAC name is (E)-2-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-oxopyrrolidin-1-yl)ethenediazonium.
| Compound Name | (E)-2-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-oxopyrrolidin-1-yl)ethenediazonium |
|---|---|
| PubChem CID | 125488273 |
| Molecular Formula | C13H14N3O4S+ |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (E)-2-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-oxopyrrolidin-1-yl)ethenediazonium |
| SMILES | Cc1ccc(S(=O)(=O)/C([N+]#N)=C(/O)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C13H13N3O4S/c1-9-4-6-10(7-5-9)21(19,20)12(15-14)13(18)16-8-2-3-11(16)17/h4-7H,2-3,8H2,1H3/p+1/b13-12+ |
| InChIKey | FOXIHNWXJSFJMJ-OUKQBFOZSA-O |
| XLogP | 1.93 |
| TPSA | 102.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|