C19H23NO — CID 125488579
(1R,2S)-1-cyclohexyl-2-phenyl-2-pyridin-2-ylethanol (PubChem CID 125488579) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (1R,2S)-1-cyclohexyl-2-phenyl-2-pyridin-2-ylethanol.
| Compound Name | (1R,2S)-1-cyclohexyl-2-phenyl-2-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 125488579 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (1R,2S)-1-cyclohexyl-2-phenyl-2-pyridin-2-ylethanol |
| SMILES | O[C@H](C1CCCCC1)[C@@H](c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H23NO/c21-19(16-11-5-2-6-12-16)18(15-9-3-1-4-10-15)17-13-7-8-14-20-17/h1,3-4,7-10,13-14,16,18-19,21H,2,5-6,11-12H2/t18-,19+/m0/s1 |
| InChIKey | RNUAIBASTLHPIT-RBUKOAKNSA-N |
| XLogP | 4.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |