About 7-bromobenzo[h]quinoline
7-bromobenzo[h]quinoline (PubChem CID 12548908) has the molecular formula C13H8BrN
and a molecular weight of 258.12 g/mol. Its IUPAC name is 7-bromobenzo[h]quinoline.
Molecular Properties
| Compound Name | 7-bromobenzo[h]quinoline |
| PubChem CID | 12548908 |
| Molecular Formula | C13H8BrN |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 7-bromobenzo[h]quinoline |
| SMILES | Brc1cccc2c1ccc1cccnc12 |
| InChI | InChI=1S/C13H8BrN/c14-12-5-1-4-11-10(12)7-6-9-3-2-8-15-13(9)11/h1-8H |
| InChIKey | XMRNYBKUPTZTSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-bromobenzo[h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromobenzo[h]quinoline?
The IUPAC name of 7-bromobenzo[h]quinoline (CID 12548908) is 7-bromobenzo[h]quinoline.
What is the SMILES notation for 7-bromobenzo[h]quinoline?
The canonical SMILES for 7-bromobenzo[h]quinoline is Brc1cccc2c1ccc1cccnc12.
What is the InChIKey of 7-bromobenzo[h]quinoline?
The InChIKey is XMRNYBKUPTZTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN/c14-12-5-1-4-11-10(12)7-6-9-3-2-8-15-13(9)11/h1-8H.
What are the key properties of 7-bromobenzo[h]quinoline?
7-bromobenzo[h]quinoline has a molecular weight of 258.12 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromobenzo[h]quinoline is sourced from PubChem (CID 12548908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).