C7H8F2O2 — CID 125489195
(2R)-3,4-difluoro-2-propyl-2H-furan-5-one (PubChem CID 125489195) has the molecular formula C7H8F2O2 and a molecular weight of 162.13 g/mol. Its IUPAC name is (2R)-3,4-difluoro-2-propyl-2H-furan-5-one.
| Compound Name | (2R)-3,4-difluoro-2-propyl-2H-furan-5-one |
|---|---|
| PubChem CID | 125489195 |
| Molecular Formula | C7H8F2O2 |
| Molecular Weight | 162.13 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (2R)-3,4-difluoro-2-propyl-2H-furan-5-one |
| SMILES | CCC[C@H]1OC(=O)C(F)=C1F |
| InChI | InChI=1S/C7H8F2O2/c1-2-3-4-5(8)6(9)7(10)11-4/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | CZJQWXWMDHHULG-SCSAIBSYSA-N |
| XLogP | 1.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |