About (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile
(3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile (PubChem CID 125490018) has the molecular formula C12H10BrFN4S
and a molecular weight of 341.21 g/mol. Its IUPAC name is (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile.
Molecular Properties
| Compound Name | (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile |
| PubChem CID | 125490018 |
| Molecular Formula | C12H10BrFN4S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile |
| SMILES | N#C[C@H]1CCCN(c2nc3c(F)cnc(Br)c3s2)C1 |
| InChI | InChI=1S/C12H10BrFN4S/c13-11-10-9(8(14)5-16-11)17-12(19-10)18-3-1-2-7(4-15)6-18/h5,7H,1-3,6H2/t7-/m1/s1 |
| InChIKey | GZTCFRCZVGILRG-SSDOTTSWSA-N |
| XLogP | 3.33 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile?
The IUPAC name of (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile (CID 125490018) is (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile.
What is the SMILES notation for (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile?
The canonical SMILES for (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile is N#C[C@H]1CCCN(c2nc3c(F)cnc(Br)c3s2)C1.
What is the InChIKey of (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile?
The InChIKey is GZTCFRCZVGILRG-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H10BrFN4S/c13-11-10-9(8(14)5-16-11)17-12(19-10)18-3-1-2-7(4-15)6-18/h5,7H,1-3,6H2/t7-/m1/s1.
What are the key properties of (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile?
(3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile has a molecular weight of 341.21 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4-bromo-7-fluoro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-3-carbonitrile is sourced from PubChem (CID 125490018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).