C15H23BrN2O2 — CID 125490373
5-bromo-6-methyl-N-[(2R)-octan-2-yl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 125490373) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 5-bromo-6-methyl-N-[(2R)-octan-2-yl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-bromo-6-methyl-N-[(2R)-octan-2-yl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125490373 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-bromo-6-methyl-N-[(2R)-octan-2-yl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)c1cc(Br)c(C)[nH]c1=O |
| InChI | InChI=1S/C15H23BrN2O2/c1-4-5-6-7-8-10(2)17-14(19)12-9-13(16)11(3)18-15(12)20/h9-10H,4-8H2,1-3H3,(H,17,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | BIPHBTYLIJGYGD-SNVBAGLBSA-N |
| XLogP | 3.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|