About (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one
(3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one (PubChem CID 125490477) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one.
Molecular Properties
| Compound Name | (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one |
| PubChem CID | 125490477 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one |
| SMILES | CC(C)[C@H]1SCC(=O)ON1C |
| InChI | InChI=1S/C7H13NO2S/c1-5(2)7-8(3)10-6(9)4-11-7/h5,7H,4H2,1-3H3/t7-/m1/s1 |
| InChIKey | ORNQHUNAFURHAR-SSDOTTSWSA-N |
| XLogP | 1.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one?
The IUPAC name of (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one (CID 125490477) is (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one.
What is the SMILES notation for (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one?
The canonical SMILES for (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one is CC(C)[C@H]1SCC(=O)ON1C.
What is the InChIKey of (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one?
The InChIKey is ORNQHUNAFURHAR-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-5(2)7-8(3)10-6(9)4-11-7/h5,7H,4H2,1-3H3/t7-/m1/s1.
What are the key properties of (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one?
(3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one has a molecular weight of 175.25 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-methyl-3-propan-2-yl-1,4,2-oxathiazinan-6-one is sourced from PubChem (CID 125490477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).