About 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide
5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 125490555) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 125490555 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCc1cc(C(=O)N(C)C)c(=O)[nH]c1C |
| InChI | InChI=1S/C11H16N2O2/c1-5-8-6-9(11(15)13(3)4)10(14)12-7(8)2/h6H,5H2,1-4H3,(H,12,14) |
| InChIKey | IFBANGASHNOPQC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide (CID 125490555) is 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide is CCc1cc(C(=O)N(C)C)c(=O)[nH]c1C.
What is the InChIKey of 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide?
The InChIKey is IFBANGASHNOPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-5-8-6-9(11(15)13(3)4)10(14)12-7(8)2/h6H,5H2,1-4H3,(H,12,14).
What are the key properties of 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide?
5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide has a molecular weight of 208.26 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,N,6-trimethyl-2-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 125490555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).