About (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine
(3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine (PubChem CID 125490676) has the molecular formula C13H20BrN3O
and a molecular weight of 314.23 g/mol. Its IUPAC name is (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine.
Molecular Properties
| Compound Name | (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine |
| PubChem CID | 125490676 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine |
| SMILES | Brc1cnn([C@@H]2CCC[C@@H](N[C@@H]3CCOC3)C2)c1 |
| InChI | InChI=1S/C13H20BrN3O/c14-10-7-15-17(8-10)13-3-1-2-11(6-13)16-12-4-5-18-9-12/h7-8,11-13,16H,1-6,9H2/t11-,12-,13-/m1/s1 |
| InChIKey | FWRACMZGXKSBHP-JHJVBQTASA-N |
| XLogP | 2.51 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine?
The IUPAC name of (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine (CID 125490676) is (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine.
What is the SMILES notation for (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine?
The canonical SMILES for (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine is Brc1cnn([C@@H]2CCC[C@@H](N[C@@H]3CCOC3)C2)c1.
What is the InChIKey of (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine?
The InChIKey is FWRACMZGXKSBHP-JHJVBQTASA-N. The full InChI is InChI=1S/C13H20BrN3O/c14-10-7-15-17(8-10)13-3-1-2-11(6-13)16-12-4-5-18-9-12/h7-8,11-13,16H,1-6,9H2/t11-,12-,13-/m1/s1.
What are the key properties of (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine?
(3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine has a molecular weight of 314.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(1R,3R)-3-(4-bromopyrazol-1-yl)cyclohexyl]oxolan-3-amine is sourced from PubChem (CID 125490676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).