C13H11IN2O — CID 125490904
N-[(3-iodophenyl)methyl]pyridine-3-carboxamide (PubChem CID 125490904) has the molecular formula C13H11IN2O and a molecular weight of 338.15 g/mol. Its IUPAC name is N-[(3-iodophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[(3-iodophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125490904 |
| Molecular Formula | C13H11IN2O |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-[(3-iodophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(I)c1)c1cccnc1 |
| InChI | InChI=1S/C13H11IN2O/c14-12-5-1-3-10(7-12)8-16-13(17)11-4-2-6-15-9-11/h1-7,9H,8H2,(H,16,17) |
| InChIKey | MBJYLWXLUDAWBE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|