About 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide
3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide (PubChem CID 12549123) has the molecular formula C17H22BrNO
and a molecular weight of 336.27 g/mol. Its IUPAC name is 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide |
| PubChem CID | 12549123 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide |
| SMILES | Br.CN(C)CC(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO.BrH/c1-18(2)13-16(19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15;/h3-12,16-17,19H,13H2,1-2H3;1H |
| InChIKey | PEKNPSWNGOYWHG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide?
The IUPAC name of 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide (CID 12549123) is 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide.
What is the SMILES notation for 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide?
The canonical SMILES for 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide is Br.CN(C)CC(O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide?
The InChIKey is PEKNPSWNGOYWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO.BrH/c1-18(2)13-16(19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15;/h3-12,16-17,19H,13H2,1-2H3;1H.
What are the key properties of 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide?
3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide has a molecular weight of 336.27 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-1,1-diphenylpropan-2-ol;hydrobromide is sourced from PubChem (CID 12549123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).