C10H13ClO2 — CID 125491580
4-(3-chloropropyl)-3,6-dimethylpyran-2-one (PubChem CID 125491580) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 4-(3-chloropropyl)-3,6-dimethylpyran-2-one.
| Compound Name | 4-(3-chloropropyl)-3,6-dimethylpyran-2-one |
|---|---|
| PubChem CID | 125491580 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-(3-chloropropyl)-3,6-dimethylpyran-2-one |
| SMILES | Cc1cc(CCCCl)c(C)c(=O)o1 |
| InChI | InChI=1S/C10H13ClO2/c1-7-6-9(4-3-5-11)8(2)10(12)13-7/h6H,3-5H2,1-2H3 |
| InChIKey | NFFRUKSSNGIZSF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|