C16H18N2 — CID 125491761
(3R,5R)-1,5-diphenylpyrrolidin-3-amine (PubChem CID 125491761) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3R,5R)-1,5-diphenylpyrrolidin-3-amine.
| Compound Name | (3R,5R)-1,5-diphenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 125491761 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3R,5R)-1,5-diphenylpyrrolidin-3-amine |
| SMILES | N[C@@H]1C[C@H](c2ccccc2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c17-14-11-16(13-7-3-1-4-8-13)18(12-14)15-9-5-2-6-10-15/h1-10,14,16H,11-12,17H2/t14-,16-/m1/s1 |
| InChIKey | IIDGENFCFVJEAB-GDBMZVCRSA-N |
| XLogP | 2.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |