C15H18F3N — CID 125492690
(1R,8S)-1-[4-(trifluoromethyl)phenyl]-4-azabicyclo[6.1.0]nonane (PubChem CID 125492690) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is (1R,8S)-1-[4-(trifluoromethyl)phenyl]-4-azabicyclo[6.1.0]nonane.
| Compound Name | (1R,8S)-1-[4-(trifluoromethyl)phenyl]-4-azabicyclo[6.1.0]nonane |
|---|---|
| PubChem CID | 125492690 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (1R,8S)-1-[4-(trifluoromethyl)phenyl]-4-azabicyclo[6.1.0]nonane |
| SMILES | FC(F)(F)c1ccc([C@]23CCNCCC[C@H]2C3)cc1 |
| InChI | InChI=1S/C15H18F3N/c16-15(17,18)12-5-3-11(4-6-12)14-7-9-19-8-1-2-13(14)10-14/h3-6,13,19H,1-2,7-10H2/t13-,14+/m0/s1 |
| InChIKey | DWIOBZQRBCHCMK-UONOGXRCSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |