C17H15NO — CID 125493160
10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,6,11,14(18),15-hexaen-5-one (PubChem CID 125493160) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,6,11,14(18),15-hexaen-5-one.
| Compound Name | 10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,6,11,14(18),15-hexaen-5-one |
|---|---|
| PubChem CID | 125493160 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,6,11,14(18),15-hexaen-5-one |
| SMILES | O=C1C=C2CCN3C=CCc4cccc(c43)C2=CC1 |
| InChI | InChI=1S/C17H15NO/c19-14-6-7-15-13(11-14)8-10-18-9-2-4-12-3-1-5-16(15)17(12)18/h1-3,5,7,9,11H,4,6,8,10H2 |
| InChIKey | SCRVRCKATYFMBK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |