About (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide
(4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide (PubChem CID 125493289) has the molecular formula C9H16INO2S
and a molecular weight of 329.20 g/mol. Its IUPAC name is (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide.
Molecular Properties
| Compound Name | (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide |
| PubChem CID | 125493289 |
| Molecular Formula | C9H16INO2S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide |
| SMILES | O=S1(=O)C[C@H](I)CC2(CCCCC2)N1 |
| InChI | InChI=1S/C9H16INO2S/c10-8-6-9(4-2-1-3-5-9)11-14(12,13)7-8/h8,11H,1-7H2/t8-/m1/s1 |
| InChIKey | DMMJDKNGQNXCCT-MRVPVSSYSA-N |
| XLogP | 1.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide?
The IUPAC name of (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide (CID 125493289) is (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide.
What is the SMILES notation for (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide?
The canonical SMILES for (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide is O=S1(=O)C[C@H](I)CC2(CCCCC2)N1.
What is the InChIKey of (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide?
The InChIKey is DMMJDKNGQNXCCT-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16INO2S/c10-8-6-9(4-2-1-3-5-9)11-14(12,13)7-8/h8,11H,1-7H2/t8-/m1/s1.
What are the key properties of (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide?
(4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide has a molecular weight of 329.20 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-iodo-2λ6-thia-1-azaspiro[5.5]undecane 2,2-dioxide is sourced from PubChem (CID 125493289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).