C14H27BrO3Si — CID 125493441
ethyl (E,2R)-5-bromo-2-methyl-2-triethylsilyloxypent-4-enoate (PubChem CID 125493441) has the molecular formula C14H27BrO3Si and a molecular weight of 351.36 g/mol. Its IUPAC name is ethyl (E,2R)-5-bromo-2-methyl-2-triethylsilyloxypent-4-enoate.
| Compound Name | ethyl (E,2R)-5-bromo-2-methyl-2-triethylsilyloxypent-4-enoate |
|---|---|
| PubChem CID | 125493441 |
| Molecular Formula | C14H27BrO3Si |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl (E,2R)-5-bromo-2-methyl-2-triethylsilyloxypent-4-enoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C/Br)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H27BrO3Si/c1-6-17-13(16)14(5,11-10-12-15)18-19(7-2,8-3)9-4/h10,12H,6-9,11H2,1-5H3/b12-10+/t14-/m1/s1 |
| InChIKey | LUIGGBIVPDYNTO-IEZBTEQYSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|