About N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine
N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine (PubChem CID 125493616) has the molecular formula C20H32Cl2N2OSi
and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine.
Molecular Properties
| Compound Name | N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine |
| PubChem CID | 125493616 |
| Molecular Formula | C20H32Cl2N2OSi |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine |
| SMILES | CC[Si](CC)(CC)O[C@H](CNC1CC2(CCC2)C1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C20H32Cl2N2OSi/c1-4-26(5-2,6-3)25-18(19-16(21)12-23-13-17(19)22)14-24-15-10-20(11-15)8-7-9-20/h12-13,15,18,24H,4-11,14H2,1-3H3/t18-/m1/s1 |
| InChIKey | PXCYVPFKVCCYLV-GOSISDBHSA-N |
| XLogP | 6.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine?
The IUPAC name of N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine (CID 125493616) is N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine.
What is the SMILES notation for N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine?
The canonical SMILES for N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine is CC[Si](CC)(CC)O[C@H](CNC1CC2(CCC2)C1)c1c(Cl)cncc1Cl.
What is the InChIKey of N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine?
The InChIKey is PXCYVPFKVCCYLV-GOSISDBHSA-N. The full InChI is InChI=1S/C20H32Cl2N2OSi/c1-4-26(5-2,6-3)25-18(19-16(21)12-23-13-17(19)22)14-24-15-10-20(11-15)8-7-9-20/h12-13,15,18,24H,4-11,14H2,1-3H3/t18-/m1/s1.
What are the key properties of N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine?
N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine has a molecular weight of 415.48 g/mol, XLogP of 6.37, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine is sourced from PubChem (CID 125493616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).