C20H32Cl2N2OSi — CID 125493616
N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine (PubChem CID 125493616) has the molecular formula C20H32Cl2N2OSi and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine.
| Compound Name | N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine |
|---|---|
| PubChem CID | 125493616 |
| Molecular Formula | C20H32Cl2N2OSi |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(2S)-2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-2-amine |
| SMILES | CC[Si](CC)(CC)O[C@H](CNC1CC2(CCC2)C1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C20H32Cl2N2OSi/c1-4-26(5-2,6-3)25-18(19-16(21)12-23-13-17(19)22)14-24-15-10-20(11-15)8-7-9-20/h12-13,15,18,24H,4-11,14H2,1-3H3/t18-/m1/s1 |
| InChIKey | PXCYVPFKVCCYLV-GOSISDBHSA-N |
| XLogP | 6.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|