C10H4F5N3 — CID 125493633
5-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine (PubChem CID 125493633) has the molecular formula C10H4F5N3 and a molecular weight of 261.15 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 125493633 |
| Molecular Formula | C10H4F5N3 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2c(F)c(F)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C10H4F5N3/c11-5-4(3-1-17-10(16)18-2-3)6(12)8(14)9(15)7(5)13/h1-2H,(H2,16,17,18) |
| InChIKey | ZXNPAMWQLUBMEP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|