About 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile
5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile (PubChem CID 125493996) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile.
Molecular Properties
| Compound Name | 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile |
| PubChem CID | 125493996 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile |
| SMILES | C[C@@H]1O[C@@H]1CCCCC#N |
| InChI | InChI=1S/C8H13NO/c1-7-8(10-7)5-3-2-4-6-9/h7-8H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | RSNDLWPTJSYDNN-JGVFFNPUSA-N |
| XLogP | 1.86 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile?
The IUPAC name of 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile (CID 125493996) is 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile.
What is the SMILES notation for 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile?
The canonical SMILES for 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile is C[C@@H]1O[C@@H]1CCCCC#N.
What is the InChIKey of 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile?
The InChIKey is RSNDLWPTJSYDNN-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H13NO/c1-7-8(10-7)5-3-2-4-6-9/h7-8H,2-5H2,1H3/t7-,8+/m0/s1.
What are the key properties of 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile?
5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile has a molecular weight of 139.20 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,3S)-3-methyloxiran-2-yl]pentanenitrile is sourced from PubChem (CID 125493996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).