About 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate
3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate (PubChem CID 125494010) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate |
| PubChem CID | 125494010 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate |
| SMILES | COc1ncc(CCCOC(C)=O)c(OC)n1 |
| InChI | InChI=1S/C11H16N2O4/c1-8(14)17-6-4-5-9-7-12-11(16-3)13-10(9)15-2/h7H,4-6H2,1-3H3 |
| InChIKey | WWXAVHHVBPHCIM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate?
The IUPAC name of 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate (CID 125494010) is 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate.
What is the SMILES notation for 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate?
The canonical SMILES for 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate is COc1ncc(CCCOC(C)=O)c(OC)n1.
What is the InChIKey of 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate?
The InChIKey is WWXAVHHVBPHCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-8(14)17-6-4-5-9-7-12-11(16-3)13-10(9)15-2/h7H,4-6H2,1-3H3.
What are the key properties of 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate?
3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate has a molecular weight of 240.26 g/mol, XLogP of 0.99, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxypyrimidin-5-yl)propyl acetate is sourced from PubChem (CID 125494010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).