About 1-benzyl-4,6-dimethylquinolin-1-ium chloride
1-benzyl-4,6-dimethylquinolin-1-ium chloride (PubChem CID 12549420) has the molecular formula C18H18ClN
and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-benzyl-4,6-dimethylquinolin-1-ium chloride.
Molecular Properties
| Compound Name | 1-benzyl-4,6-dimethylquinolin-1-ium chloride |
| PubChem CID | 12549420 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-benzyl-4,6-dimethylquinolin-1-ium chloride |
| SMILES | Cc1ccc2c(c1)c(C)cc[n+]2Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H18N.ClH/c1-14-8-9-18-17(12-14)15(2)10-11-19(18)13-16-6-4-3-5-7-16;/h3-12H,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZPWUWWJKUYZCKZ-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4,6-dimethylquinolin-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,6-dimethylquinolin-1-ium chloride?
The IUPAC name of 1-benzyl-4,6-dimethylquinolin-1-ium chloride (CID 12549420) is 1-benzyl-4,6-dimethylquinolin-1-ium chloride.
What is the SMILES notation for 1-benzyl-4,6-dimethylquinolin-1-ium chloride?
The canonical SMILES for 1-benzyl-4,6-dimethylquinolin-1-ium chloride is Cc1ccc2c(c1)c(C)cc[n+]2Cc1ccccc1.[Cl-].
What is the InChIKey of 1-benzyl-4,6-dimethylquinolin-1-ium chloride?
The InChIKey is ZPWUWWJKUYZCKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H18N.ClH/c1-14-8-9-18-17(12-14)15(2)10-11-19(18)13-16-6-4-3-5-7-16;/h3-12H,13H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-benzyl-4,6-dimethylquinolin-1-ium chloride?
1-benzyl-4,6-dimethylquinolin-1-ium chloride has a molecular weight of 283.80 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,6-dimethylquinolin-1-ium chloride is sourced from PubChem (CID 12549420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).